C18H24FN5OS — CID 9317827
2-[[3-(4-fluorophenyl)-4-prop-2-enyl-5-sulfanylidene-1,2,4-triazol-1-yl]methyl-methylamino]-N-propan-2-ylacetamide (PubChem CID 9317827) has the molecular formula C18H24FN5OS and a molecular weight of 377.49 g/mol. Its IUPAC name is 2-[[3-(4-fluorophenyl)-4-prop-2-enyl-5-sulfanylidene-1,2,4-triazol-1-yl]methyl-methylamino]-N-propan-2-ylacetamide.
| Compound Name | 2-[[3-(4-fluorophenyl)-4-prop-2-enyl-5-sulfanylidene-1,2,4-triazol-1-yl]methyl-methylamino]-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 9317827 |
| Molecular Formula | C18H24FN5OS |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | 2-[[3-(4-fluorophenyl)-4-prop-2-enyl-5-sulfanylidene-1,2,4-triazol-1-yl]methyl-methylamino]-N-propan-2-ylacetamide |
| SMILES | C=CCn1c(-c2ccc(F)cc2)nn(CN(C)CC(=O)NC(C)C)c1=S |
| InChI | InChI=1S/C18H24FN5OS/c1-5-10-23-17(14-6-8-15(19)9-7-14)21-24(18(23)26)12-22(4)11-16(25)20-13(2)3/h5-9,13H,1,10-12H2,2-4H3,(H,20,25) |
| InChIKey | IORYXQJGBBRVQE-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 55.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|