C21H26N4O2S3 — CID 25328725
2-[[butyl-[(3S)-1,1-dioxothiolan-3-yl]amino]methyl]-4-phenyl-5-thiophen-2-yl-1,2,4-triazole-3-thione (PubChem CID 25328725) has the molecular formula C21H26N4O2S3 and a molecular weight of 462.67 g/mol. Its IUPAC name is 2-[[butyl-[(3S)-1,1-dioxothiolan-3-yl]amino]methyl]-4-phenyl-5-thiophen-2-yl-1,2,4-triazole-3-thione.
| Compound Name | 2-[[butyl-[(3S)-1,1-dioxothiolan-3-yl]amino]methyl]-4-phenyl-5-thiophen-2-yl-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 25328725 |
| Molecular Formula | C21H26N4O2S3 |
| Molecular Weight | 462.67 g/mol |
| Exact Mass | 462.12 |
| IUPAC Name | 2-[[butyl-[(3S)-1,1-dioxothiolan-3-yl]amino]methyl]-4-phenyl-5-thiophen-2-yl-1,2,4-triazole-3-thione |
| SMILES | CCCCN(Cn1nc(-c2cccs2)n(-c2ccccc2)c1=S)[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C21H26N4O2S3/c1-2-3-12-23(18-11-14-30(26,27)15-18)16-24-21(28)25(17-8-5-4-6-9-17)20(22-24)19-10-7-13-29-19/h4-10,13,18H,2-3,11-12,14-16H2,1H3/t18-/m0/s1 |
| InChIKey | MLQAEZSVDIBARN-SFHVURJKSA-N |
| XLogP | 4.38 |
| TPSA | 60.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.67 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|