C19H29N5O2S2 — CID 42933824
1-[[butyl-(1,1-dioxothiolan-3-yl)amino]methyl]-4-(4-propan-2-ylphenyl)tetrazole-5-thione (PubChem CID 42933824) has the molecular formula C19H29N5O2S2 and a molecular weight of 423.61 g/mol. Its IUPAC name is 1-[[butyl-(1,1-dioxothiolan-3-yl)amino]methyl]-4-(4-propan-2-ylphenyl)tetrazole-5-thione.
| Compound Name | 1-[[butyl-(1,1-dioxothiolan-3-yl)amino]methyl]-4-(4-propan-2-ylphenyl)tetrazole-5-thione |
|---|---|
| PubChem CID | 42933824 |
| Molecular Formula | C19H29N5O2S2 |
| Molecular Weight | 423.61 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | 1-[[butyl-(1,1-dioxothiolan-3-yl)amino]methyl]-4-(4-propan-2-ylphenyl)tetrazole-5-thione |
| SMILES | CCCCN(Cn1nnn(-c2ccc(C(C)C)cc2)c1=S)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C19H29N5O2S2/c1-4-5-11-22(18-10-12-28(25,26)13-18)14-23-19(27)24(21-20-23)17-8-6-16(7-9-17)15(2)3/h6-9,15,18H,4-5,10-14H2,1-3H3 |
| InChIKey | LVRAXQIDBDMGJG-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 73.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.61 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|