C16H25NO3S — CID 111110027
2-[butyl-(1,1-dioxothiolan-3-yl)amino]-1-phenylethanol (PubChem CID 111110027) has the molecular formula C16H25NO3S and a molecular weight of 311.45 g/mol. Its IUPAC name is 2-[butyl-(1,1-dioxothiolan-3-yl)amino]-1-phenylethanol.
| Compound Name | 2-[butyl-(1,1-dioxothiolan-3-yl)amino]-1-phenylethanol |
|---|---|
| PubChem CID | 111110027 |
| Molecular Formula | C16H25NO3S |
| Molecular Weight | 311.45 g/mol |
| Exact Mass | 311.16 |
| IUPAC Name | 2-[butyl-(1,1-dioxothiolan-3-yl)amino]-1-phenylethanol |
| SMILES | CCCCN(CC(O)c1ccccc1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C16H25NO3S/c1-2-3-10-17(15-9-11-21(19,20)13-15)12-16(18)14-7-5-4-6-8-14/h4-8,15-16,18H,2-3,9-13H2,1H3 |
| InChIKey | MVTMDPNNABPQPG-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.45 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |