C22H24ClFN4O2S2 — CID 24605582
5-(2-chlorophenyl)-2-[[(1,1-dioxothiolan-3-yl)-propylamino]methyl]-4-(2-fluorophenyl)-1,2,4-triazole-3-thione (PubChem CID 24605582) has the molecular formula C22H24ClFN4O2S2 and a molecular weight of 495.05 g/mol. Its IUPAC name is 5-(2-chlorophenyl)-2-[[(1,1-dioxothiolan-3-yl)-propylamino]methyl]-4-(2-fluorophenyl)-1,2,4-triazole-3-thione.
| Compound Name | 5-(2-chlorophenyl)-2-[[(1,1-dioxothiolan-3-yl)-propylamino]methyl]-4-(2-fluorophenyl)-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 24605582 |
| Molecular Formula | C22H24ClFN4O2S2 |
| Molecular Weight | 495.05 g/mol |
| Exact Mass | 494.10 |
| IUPAC Name | 5-(2-chlorophenyl)-2-[[(1,1-dioxothiolan-3-yl)-propylamino]methyl]-4-(2-fluorophenyl)-1,2,4-triazole-3-thione |
| SMILES | CCCN(Cn1nc(-c2ccccc2Cl)n(-c2ccccc2F)c1=S)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C22H24ClFN4O2S2/c1-2-12-26(16-11-13-32(29,30)14-16)15-27-22(31)28(20-10-6-5-9-19(20)24)21(25-27)17-7-3-4-8-18(17)23/h3-10,16H,2,11-15H2,1H3 |
| InChIKey | KRLKCOSZLRFSCM-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 60.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.05 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|