C13H14ClN3OS3 — CID 4002327
2-[[4-(4-chlorophenyl)-5-sulfanylidene-1,3,4-thiadiazol-2-yl]sulfanyl]-N-propylacetamide (PubChem CID 4002327) has the molecular formula C13H14ClN3OS3 and a molecular weight of 359.93 g/mol. Its IUPAC name is 2-[[4-(4-chlorophenyl)-5-sulfanylidene-1,3,4-thiadiazol-2-yl]sulfanyl]-N-propylacetamide.
| Compound Name | 2-[[4-(4-chlorophenyl)-5-sulfanylidene-1,3,4-thiadiazol-2-yl]sulfanyl]-N-propylacetamide |
|---|---|
| PubChem CID | 4002327 |
| Molecular Formula | C13H14ClN3OS3 |
| Molecular Weight | 359.93 g/mol |
| Exact Mass | 359.00 |
| IUPAC Name | 2-[[4-(4-chlorophenyl)-5-sulfanylidene-1,3,4-thiadiazol-2-yl]sulfanyl]-N-propylacetamide |
| SMILES | CCCNC(=O)CSc1nn(-c2ccc(Cl)cc2)c(=S)s1 |
| InChI | InChI=1S/C13H14ClN3OS3/c1-2-7-15-11(18)8-20-12-16-17(13(19)21-12)10-5-3-9(14)4-6-10/h3-6H,2,7-8H2,1H3,(H,15,18) |
| InChIKey | SUTWCLNNVBTCII-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.93 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|