C18H20ClN3OS3 — CID 2424339
2-[[4-(4-chlorophenyl)-5-sulfanylidene-1,3,4-thiadiazol-2-yl]sulfanyl]-N-[2-(cyclohexen-1-yl)ethyl]acetamide (PubChem CID 2424339) has the molecular formula C18H20ClN3OS3 and a molecular weight of 426.03 g/mol. Its IUPAC name is 2-[[4-(4-chlorophenyl)-5-sulfanylidene-1,3,4-thiadiazol-2-yl]sulfanyl]-N-[2-(cyclohexen-1-yl)ethyl]acetamide.
| Compound Name | 2-[[4-(4-chlorophenyl)-5-sulfanylidene-1,3,4-thiadiazol-2-yl]sulfanyl]-N-[2-(cyclohexen-1-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 2424339 |
| Molecular Formula | C18H20ClN3OS3 |
| Molecular Weight | 426.03 g/mol |
| Exact Mass | 425.05 |
| IUPAC Name | 2-[[4-(4-chlorophenyl)-5-sulfanylidene-1,3,4-thiadiazol-2-yl]sulfanyl]-N-[2-(cyclohexen-1-yl)ethyl]acetamide |
| SMILES | O=C(CSc1nn(-c2ccc(Cl)cc2)c(=S)s1)NCCC1=CCCCC1 |
| InChI | InChI=1S/C18H20ClN3OS3/c19-14-6-8-15(9-7-14)22-18(24)26-17(21-22)25-12-16(23)20-11-10-13-4-2-1-3-5-13/h4,6-9H,1-3,5,10-12H2,(H,20,23) |
| InChIKey | MLCNHCIQKIMGFF-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.03 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|