C11H11ClN2OS3 — CID 99800776
3-(4-chlorophenyl)-5-[(2R)-2-hydroxypropyl]sulfanyl-1,3,4-thiadiazole-2-thione (PubChem CID 99800776) has the molecular formula C11H11ClN2OS3 and a molecular weight of 318.88 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-5-[(2R)-2-hydroxypropyl]sulfanyl-1,3,4-thiadiazole-2-thione.
| Compound Name | 3-(4-chlorophenyl)-5-[(2R)-2-hydroxypropyl]sulfanyl-1,3,4-thiadiazole-2-thione |
|---|---|
| PubChem CID | 99800776 |
| Molecular Formula | C11H11ClN2OS3 |
| Molecular Weight | 318.88 g/mol |
| Exact Mass | 317.97 |
| IUPAC Name | 3-(4-chlorophenyl)-5-[(2R)-2-hydroxypropyl]sulfanyl-1,3,4-thiadiazole-2-thione |
| SMILES | C[C@@H](O)CSc1nn(-c2ccc(Cl)cc2)c(=S)s1 |
| InChI | InChI=1S/C11H11ClN2OS3/c1-7(15)6-17-10-13-14(11(16)18-10)9-4-2-8(12)3-5-9/h2-5,7,15H,6H2,1H3/t7-/m1/s1 |
| InChIKey | ALRYXIRXPPCFTO-SSDOTTSWSA-N |
| XLogP | 3.79 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.88 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|