C16H10ClN3S3 — CID 3269537
4-[[4-(4-chlorophenyl)-5-sulfanylidene-1,3,4-thiadiazol-2-yl]sulfanylmethyl]benzonitrile (PubChem CID 3269537) has the molecular formula C16H10ClN3S3 and a molecular weight of 375.93 g/mol. Its IUPAC name is 4-[[4-(4-chlorophenyl)-5-sulfanylidene-1,3,4-thiadiazol-2-yl]sulfanylmethyl]benzonitrile.
| Compound Name | 4-[[4-(4-chlorophenyl)-5-sulfanylidene-1,3,4-thiadiazol-2-yl]sulfanylmethyl]benzonitrile |
|---|---|
| PubChem CID | 3269537 |
| Molecular Formula | C16H10ClN3S3 |
| Molecular Weight | 375.93 g/mol |
| Exact Mass | 374.97 |
| IUPAC Name | 4-[[4-(4-chlorophenyl)-5-sulfanylidene-1,3,4-thiadiazol-2-yl]sulfanylmethyl]benzonitrile |
| SMILES | N#Cc1ccc(CSc2nn(-c3ccc(Cl)cc3)c(=S)s2)cc1 |
| InChI | InChI=1S/C16H10ClN3S3/c17-13-5-7-14(8-6-13)20-16(21)23-15(19-20)22-10-12-3-1-11(9-18)2-4-12/h1-8H,10H2 |
| InChIKey | AAPSHVDNDWJBOF-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 41.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.93 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|