C16H12Cl2N2OS3 — CID 3971776
5-[2-(2-chlorophenoxy)ethylsulfanyl]-3-(4-chlorophenyl)-1,3,4-thiadiazole-2-thione (PubChem CID 3971776) has the molecular formula C16H12Cl2N2OS3 and a molecular weight of 415.39 g/mol. Its IUPAC name is 5-[2-(2-chlorophenoxy)ethylsulfanyl]-3-(4-chlorophenyl)-1,3,4-thiadiazole-2-thione.
| Compound Name | 5-[2-(2-chlorophenoxy)ethylsulfanyl]-3-(4-chlorophenyl)-1,3,4-thiadiazole-2-thione |
|---|---|
| PubChem CID | 3971776 |
| Molecular Formula | C16H12Cl2N2OS3 |
| Molecular Weight | 415.39 g/mol |
| Exact Mass | 413.95 |
| IUPAC Name | 5-[2-(2-chlorophenoxy)ethylsulfanyl]-3-(4-chlorophenyl)-1,3,4-thiadiazole-2-thione |
| SMILES | S=c1sc(SCCOc2ccccc2Cl)nn1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H12Cl2N2OS3/c17-11-5-7-12(8-6-11)20-16(22)24-15(19-20)23-10-9-21-14-4-2-1-3-13(14)18/h1-8H,9-10H2 |
| InChIKey | SMBDIUZPVUFZJJ-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.39 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|