C16H13BrN2OS3 — CID 2091729
5-[2-(3-bromophenoxy)ethylsulfanyl]-3-phenyl-1,3,4-thiadiazole-2-thione (PubChem CID 2091729) has the molecular formula C16H13BrN2OS3 and a molecular weight of 425.40 g/mol. Its IUPAC name is 5-[2-(3-bromophenoxy)ethylsulfanyl]-3-phenyl-1,3,4-thiadiazole-2-thione.
| Compound Name | 5-[2-(3-bromophenoxy)ethylsulfanyl]-3-phenyl-1,3,4-thiadiazole-2-thione |
|---|---|
| PubChem CID | 2091729 |
| Molecular Formula | C16H13BrN2OS3 |
| Molecular Weight | 425.40 g/mol |
| Exact Mass | 423.94 |
| IUPAC Name | 5-[2-(3-bromophenoxy)ethylsulfanyl]-3-phenyl-1,3,4-thiadiazole-2-thione |
| SMILES | S=c1sc(SCCOc2cccc(Br)c2)nn1-c1ccccc1 |
| InChI | InChI=1S/C16H13BrN2OS3/c17-12-5-4-8-14(11-12)20-9-10-22-15-18-19(16(21)23-15)13-6-2-1-3-7-13/h1-8,11H,9-10H2 |
| InChIKey | GLXLEMQHRQZDKR-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.40 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|