C17H15N3O3S3 — CID 60529143
5-[3-(4-nitrophenoxy)propylsulfanyl]-3-phenyl-1,3,4-thiadiazole-2-thione (PubChem CID 60529143) has the molecular formula C17H15N3O3S3 and a molecular weight of 405.53 g/mol. Its IUPAC name is 5-[3-(4-nitrophenoxy)propylsulfanyl]-3-phenyl-1,3,4-thiadiazole-2-thione.
| Compound Name | 5-[3-(4-nitrophenoxy)propylsulfanyl]-3-phenyl-1,3,4-thiadiazole-2-thione |
|---|---|
| PubChem CID | 60529143 |
| Molecular Formula | C17H15N3O3S3 |
| Molecular Weight | 405.53 g/mol |
| Exact Mass | 405.03 |
| IUPAC Name | 5-[3-(4-nitrophenoxy)propylsulfanyl]-3-phenyl-1,3,4-thiadiazole-2-thione |
| SMILES | O=[N+]([O-])c1ccc(OCCCSc2nn(-c3ccccc3)c(=S)s2)cc1 |
| InChI | InChI=1S/C17H15N3O3S3/c21-20(22)14-7-9-15(10-8-14)23-11-4-12-25-16-18-19(17(24)26-16)13-5-2-1-3-6-13/h1-3,5-10H,4,11-12H2 |
| InChIKey | FCTDLXWYMXBCQX-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 70.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.53 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|