C16H12N6S3 — CID 27715089
3-phenyl-5-[(1-phenyltetrazol-5-yl)methylsulfanyl]-1,3,4-thiadiazole-2-thione (PubChem CID 27715089) has the molecular formula C16H12N6S3 and a molecular weight of 384.52 g/mol. Its IUPAC name is 3-phenyl-5-[(1-phenyltetrazol-5-yl)methylsulfanyl]-1,3,4-thiadiazole-2-thione.
| Compound Name | 3-phenyl-5-[(1-phenyltetrazol-5-yl)methylsulfanyl]-1,3,4-thiadiazole-2-thione |
|---|---|
| PubChem CID | 27715089 |
| Molecular Formula | C16H12N6S3 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.03 |
| IUPAC Name | 3-phenyl-5-[(1-phenyltetrazol-5-yl)methylsulfanyl]-1,3,4-thiadiazole-2-thione |
| SMILES | S=c1sc(SCc2nnnn2-c2ccccc2)nn1-c1ccccc1 |
| InChI | InChI=1S/C16H12N6S3/c23-16-22(13-9-5-2-6-10-13)18-15(25-16)24-11-14-17-19-20-21(14)12-7-3-1-4-8-12/h1-10H,11H2 |
| InChIKey | OGVOBERZPTXMTR-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 61.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|