C16H11N5OS3 — CID 7994494
3-[(4-phenyl-5-sulfanylidene-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-1,2,3-benzotriazin-4-one (PubChem CID 7994494) has the molecular formula C16H11N5OS3 and a molecular weight of 385.50 g/mol. Its IUPAC name is 3-[(4-phenyl-5-sulfanylidene-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-1,2,3-benzotriazin-4-one.
| Compound Name | 3-[(4-phenyl-5-sulfanylidene-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-1,2,3-benzotriazin-4-one |
|---|---|
| PubChem CID | 7994494 |
| Molecular Formula | C16H11N5OS3 |
| Molecular Weight | 385.50 g/mol |
| Exact Mass | 385.01 |
| IUPAC Name | 3-[(4-phenyl-5-sulfanylidene-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-1,2,3-benzotriazin-4-one |
| SMILES | O=c1c2ccccc2nnn1CSc1nn(-c2ccccc2)c(=S)s1 |
| InChI | InChI=1S/C16H11N5OS3/c22-14-12-8-4-5-9-13(12)17-19-20(14)10-24-15-18-21(16(23)25-15)11-6-2-1-3-7-11/h1-9H,10H2 |
| InChIKey | SRKDDYYJNBFZML-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 65.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.50 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|