C12H12N2O2S3 — CID 56794394
5-(1,3-dioxolan-2-ylmethylsulfanyl)-3-phenyl-1,3,4-thiadiazole-2-thione (PubChem CID 56794394) has the molecular formula C12H12N2O2S3 and a molecular weight of 312.44 g/mol. Its IUPAC name is 5-(1,3-dioxolan-2-ylmethylsulfanyl)-3-phenyl-1,3,4-thiadiazole-2-thione.
| Compound Name | 5-(1,3-dioxolan-2-ylmethylsulfanyl)-3-phenyl-1,3,4-thiadiazole-2-thione |
|---|---|
| PubChem CID | 56794394 |
| Molecular Formula | C12H12N2O2S3 |
| Molecular Weight | 312.44 g/mol |
| Exact Mass | 312.01 |
| IUPAC Name | 5-(1,3-dioxolan-2-ylmethylsulfanyl)-3-phenyl-1,3,4-thiadiazole-2-thione |
| SMILES | S=c1sc(SCC2OCCO2)nn1-c1ccccc1 |
| InChI | InChI=1S/C12H12N2O2S3/c17-12-14(9-4-2-1-3-5-9)13-11(19-12)18-8-10-15-6-7-16-10/h1-5,10H,6-8H2 |
| InChIKey | JEDWRYCAIXHIAW-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.44 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|