C12H10N2O2S3 — CID 7994425
(3R)-3-[(4-phenyl-5-sulfanylidene-1,3,4-thiadiazol-2-yl)sulfanyl]oxolan-2-one (PubChem CID 7994425) has the molecular formula C12H10N2O2S3 and a molecular weight of 310.42 g/mol. Its IUPAC name is (3R)-3-[(4-phenyl-5-sulfanylidene-1,3,4-thiadiazol-2-yl)sulfanyl]oxolan-2-one.
| Compound Name | (3R)-3-[(4-phenyl-5-sulfanylidene-1,3,4-thiadiazol-2-yl)sulfanyl]oxolan-2-one |
|---|---|
| PubChem CID | 7994425 |
| Molecular Formula | C12H10N2O2S3 |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 309.99 |
| IUPAC Name | (3R)-3-[(4-phenyl-5-sulfanylidene-1,3,4-thiadiazol-2-yl)sulfanyl]oxolan-2-one |
| SMILES | O=C1OCC[C@H]1Sc1nn(-c2ccccc2)c(=S)s1 |
| InChI | InChI=1S/C12H10N2O2S3/c15-10-9(6-7-16-10)18-11-13-14(12(17)19-11)8-4-2-1-3-5-8/h1-5,9H,6-7H2/t9-/m1/s1 |
| InChIKey | UTJWIXDSQUALTL-SECBINFHSA-N |
| XLogP | 3.07 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|