C10H6FN2O2S3- — CID 7063037
2-[[4-(4-fluorophenyl)-5-sulfanylidene-1,3,4-thiadiazol-2-yl]sulfanyl]acetate (PubChem CID 7063037) has the molecular formula C10H6FN2O2S3- and a molecular weight of 301.37 g/mol. Its IUPAC name is 2-[[4-(4-fluorophenyl)-5-sulfanylidene-1,3,4-thiadiazol-2-yl]sulfanyl]acetate.
| Compound Name | 2-[[4-(4-fluorophenyl)-5-sulfanylidene-1,3,4-thiadiazol-2-yl]sulfanyl]acetate |
|---|---|
| PubChem CID | 7063037 |
| Molecular Formula | C10H6FN2O2S3- |
| Molecular Weight | 301.37 g/mol |
| Exact Mass | 300.96 |
| IUPAC Name | 2-[[4-(4-fluorophenyl)-5-sulfanylidene-1,3,4-thiadiazol-2-yl]sulfanyl]acetate |
| SMILES | O=C([O-])CSc1nn(-c2ccc(F)cc2)c(=S)s1 |
| InChI | InChI=1S/C10H7FN2O2S3/c11-6-1-3-7(4-2-6)13-10(16)18-9(12-13)17-5-8(14)15/h1-4H,5H2,(H,14,15)/p-1 |
| InChIKey | RLUNQXFMRDUOAE-UHFFFAOYSA-M |
| XLogP | 1.64 |
| TPSA | 57.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.37 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|