C8H4FN2S3- — CID 3589844
4-(4-fluorophenyl)-5-sulfanylidene-1,3,4-thiadiazole-2-thiolate (PubChem CID 3589844) has the molecular formula C8H4FN2S3- and a molecular weight of 243.33 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-5-sulfanylidene-1,3,4-thiadiazole-2-thiolate.
| Compound Name | 4-(4-fluorophenyl)-5-sulfanylidene-1,3,4-thiadiazole-2-thiolate |
|---|---|
| PubChem CID | 3589844 |
| Molecular Formula | C8H4FN2S3- |
| Molecular Weight | 243.33 g/mol |
| Exact Mass | 242.95 |
| IUPAC Name | 4-(4-fluorophenyl)-5-sulfanylidene-1,3,4-thiadiazole-2-thiolate |
| SMILES | Fc1ccc(-n2nc([S-])sc2=S)cc1 |
| InChI | InChI=1S/C8H5FN2S3/c9-5-1-3-6(4-2-5)11-8(13)14-7(12)10-11/h1-4H,(H,10,12)/p-1 |
| InChIKey | AZIREMOINMPUJO-UHFFFAOYSA-M |
| XLogP | 2.71 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.33 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|