C8H5KN2S3 — CID 2775614
5-mercapto-3-phenyl-1,3,4-thiadiazole-2(3h)-thione, potassium salt (PubChem CID 2775614) has the molecular formula C8H5KN2S3 and a molecular weight of 264.40 g/mol. Its IUPAC name is potassium 4-phenyl-5-sulfanylidene-1,3,4-thiadiazole-2-thiolate.
| Compound Name | 5-mercapto-3-phenyl-1,3,4-thiadiazole-2(3h)-thione, potassium salt |
|---|---|
| PubChem CID | 2775614 |
| Molecular Formula | C8H5KN2S3 |
| Molecular Weight | 264.40 g/mol |
| Exact Mass | 263.93 |
| IUPAC Name | potassium 4-phenyl-5-sulfanylidene-1,3,4-thiadiazole-2-thiolate |
| SMILES | C1=CC=C(C=C1)N2C(=S)SC(=N2)[S-].[K+] |
| InChI | InChI=1S/C8H6N2S3.K/c11-7-9-10(8(12)13-7)6-4-2-1-3-5-6;/h1-5H,(H,9,11);/q;+1/p-1 |
| InChIKey | QSKDCVGFAPHSHX-UHFFFAOYSA-M |
| XLogP | — |
| TPSA | 74.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | 251 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|