C11H9FN4O2S3 — CID 3442379
N-carbamoyl-2-[[4-(4-fluorophenyl)-5-sulfanylidene-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide (PubChem CID 3442379) has the molecular formula C11H9FN4O2S3 and a molecular weight of 344.42 g/mol. Its IUPAC name is N-carbamoyl-2-[[4-(4-fluorophenyl)-5-sulfanylidene-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide.
| Compound Name | N-carbamoyl-2-[[4-(4-fluorophenyl)-5-sulfanylidene-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 3442379 |
| Molecular Formula | C11H9FN4O2S3 |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 343.99 |
| IUPAC Name | N-carbamoyl-2-[[4-(4-fluorophenyl)-5-sulfanylidene-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide |
| SMILES | NC(=O)NC(=O)CSc1nn(-c2ccc(F)cc2)c(=S)s1 |
| InChI | InChI=1S/C11H9FN4O2S3/c12-6-1-3-7(4-2-6)16-11(19)21-10(15-16)20-5-8(17)14-9(13)18/h1-4H,5H2,(H3,13,14,17,18) |
| InChIKey | ONMIIJIFWUGEBR-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|