C13H12FN3O3S3 — CID 3611886
ethyl N-[2-[[4-(4-fluorophenyl)-5-sulfanylidene-1,3,4-thiadiazol-2-yl]sulfanyl]acetyl]carbamate (PubChem CID 3611886) has the molecular formula C13H12FN3O3S3 and a molecular weight of 373.46 g/mol. Its IUPAC name is ethyl N-[2-[[4-(4-fluorophenyl)-5-sulfanylidene-1,3,4-thiadiazol-2-yl]sulfanyl]acetyl]carbamate.
| Compound Name | ethyl N-[2-[[4-(4-fluorophenyl)-5-sulfanylidene-1,3,4-thiadiazol-2-yl]sulfanyl]acetyl]carbamate |
|---|---|
| PubChem CID | 3611886 |
| Molecular Formula | C13H12FN3O3S3 |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.00 |
| IUPAC Name | ethyl N-[2-[[4-(4-fluorophenyl)-5-sulfanylidene-1,3,4-thiadiazol-2-yl]sulfanyl]acetyl]carbamate |
| SMILES | CCOC(=O)NC(=O)CSc1nn(-c2ccc(F)cc2)c(=S)s1 |
| InChI | InChI=1S/C13H12FN3O3S3/c1-2-20-11(19)15-10(18)7-22-12-16-17(13(21)23-12)9-5-3-8(14)4-6-9/h3-6H,2,7H2,1H3,(H,15,18,19) |
| InChIKey | SUMLEYWGLMDOGG-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|