C11H14FNO2S — CID 137477163
[(2R)-2-methylsulfanylpropyl] N-(4-fluorophenyl)carbamate (PubChem CID 137477163) has the molecular formula C11H14FNO2S and a molecular weight of 243.30 g/mol. Its IUPAC name is [(2R)-2-methylsulfanylpropyl] N-(4-fluorophenyl)carbamate.
| Compound Name | [(2R)-2-methylsulfanylpropyl] N-(4-fluorophenyl)carbamate |
|---|---|
| PubChem CID | 137477163 |
| Molecular Formula | C11H14FNO2S |
| Molecular Weight | 243.30 g/mol |
| Exact Mass | 243.07 |
| IUPAC Name | [(2R)-2-methylsulfanylpropyl] N-(4-fluorophenyl)carbamate |
| SMILES | CS[C@H](C)COC(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C11H14FNO2S/c1-8(16-2)7-15-11(14)13-10-5-3-9(12)4-6-10/h3-6,8H,7H2,1-2H3,(H,13,14)/t8-/m1/s1 |
| InChIKey | LCISIQQVCWPPFG-MRVPVSSYSA-N |
| XLogP | 3.13 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.30 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |