C12H17FN2O2 — CID 79338343
2-(propan-2-ylamino)ethyl N-(4-fluorophenyl)carbamate (PubChem CID 79338343) has the molecular formula C12H17FN2O2 and a molecular weight of 240.28 g/mol. Its IUPAC name is 2-(propan-2-ylamino)ethyl N-(4-fluorophenyl)carbamate.
| Compound Name | 2-(propan-2-ylamino)ethyl N-(4-fluorophenyl)carbamate |
|---|---|
| PubChem CID | 79338343 |
| Molecular Formula | C12H17FN2O2 |
| Molecular Weight | 240.28 g/mol |
| Exact Mass | 240.13 |
| IUPAC Name | 2-(propan-2-ylamino)ethyl N-(4-fluorophenyl)carbamate |
| SMILES | CC(C)NCCOC(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C12H17FN2O2/c1-9(2)14-7-8-17-12(16)15-11-5-3-10(13)4-6-11/h3-6,9,14H,7-8H2,1-2H3,(H,15,16) |
| InChIKey | CUXCHJMLJXEEDV-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.28 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|