C14H11N3O2S — CID 47262856
3-[(4-hydroxyphenyl)sulfanylmethyl]-1,2,3-benzotriazin-4-one (PubChem CID 47262856) has the molecular formula C14H11N3O2S and a molecular weight of 285.33 g/mol. Its IUPAC name is 3-[(4-hydroxyphenyl)sulfanylmethyl]-1,2,3-benzotriazin-4-one.
| Compound Name | 3-[(4-hydroxyphenyl)sulfanylmethyl]-1,2,3-benzotriazin-4-one |
|---|---|
| PubChem CID | 47262856 |
| Molecular Formula | C14H11N3O2S |
| Molecular Weight | 285.33 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | 3-[(4-hydroxyphenyl)sulfanylmethyl]-1,2,3-benzotriazin-4-one |
| SMILES | O=c1c2ccccc2nnn1CSc1ccc(O)cc1 |
| InChI | InChI=1S/C14H11N3O2S/c18-10-5-7-11(8-6-10)20-9-17-14(19)12-3-1-2-4-13(12)15-16-17/h1-8,18H,9H2 |
| InChIKey | WZXATARRUFEYCX-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.33 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |