C25H19N3OS3 — CID 2446719
1-(1-methyl-2-phenylindol-3-yl)-2-[(4-phenyl-5-sulfanylidene-1,3,4-thiadiazol-2-yl)sulfanyl]ethanone (PubChem CID 2446719) has the molecular formula C25H19N3OS3 and a molecular weight of 473.65 g/mol. Its IUPAC name is 1-(1-methyl-2-phenylindol-3-yl)-2-[(4-phenyl-5-sulfanylidene-1,3,4-thiadiazol-2-yl)sulfanyl]ethanone.
| Compound Name | 1-(1-methyl-2-phenylindol-3-yl)-2-[(4-phenyl-5-sulfanylidene-1,3,4-thiadiazol-2-yl)sulfanyl]ethanone |
|---|---|
| PubChem CID | 2446719 |
| Molecular Formula | C25H19N3OS3 |
| Molecular Weight | 473.65 g/mol |
| Exact Mass | 473.07 |
| IUPAC Name | 1-(1-methyl-2-phenylindol-3-yl)-2-[(4-phenyl-5-sulfanylidene-1,3,4-thiadiazol-2-yl)sulfanyl]ethanone |
| SMILES | Cn1c(-c2ccccc2)c(C(=O)CSc2nn(-c3ccccc3)c(=S)s2)c2ccccc21 |
| InChI | InChI=1S/C25H19N3OS3/c1-27-20-15-9-8-14-19(20)22(23(27)17-10-4-2-5-11-17)21(29)16-31-24-26-28(25(30)32-24)18-12-6-3-7-13-18/h2-15H,16H2,1H3 |
| InChIKey | BUHBLZDTPZXBJK-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 39.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.65 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|