C17H13ClN2O2S3 — CID 7488042
1-(3-chloro-4-methoxyphenyl)-2-[(4-phenyl-5-sulfanylidene-1,3,4-thiadiazol-2-yl)sulfanyl]ethanone (PubChem CID 7488042) has the molecular formula C17H13ClN2O2S3 and a molecular weight of 408.96 g/mol. Its IUPAC name is 1-(3-chloro-4-methoxyphenyl)-2-[(4-phenyl-5-sulfanylidene-1,3,4-thiadiazol-2-yl)sulfanyl]ethanone.
| Compound Name | 1-(3-chloro-4-methoxyphenyl)-2-[(4-phenyl-5-sulfanylidene-1,3,4-thiadiazol-2-yl)sulfanyl]ethanone |
|---|---|
| PubChem CID | 7488042 |
| Molecular Formula | C17H13ClN2O2S3 |
| Molecular Weight | 408.96 g/mol |
| Exact Mass | 407.98 |
| IUPAC Name | 1-(3-chloro-4-methoxyphenyl)-2-[(4-phenyl-5-sulfanylidene-1,3,4-thiadiazol-2-yl)sulfanyl]ethanone |
| SMILES | COc1ccc(C(=O)CSc2nn(-c3ccccc3)c(=S)s2)cc1Cl |
| InChI | InChI=1S/C17H13ClN2O2S3/c1-22-15-8-7-11(9-13(15)18)14(21)10-24-16-19-20(17(23)25-16)12-5-3-2-4-6-12/h2-9H,10H2,1H3 |
| InChIKey | FYNLBWHUTOARRK-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.96 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|