C12H10ClNO2S2 — CID 61218742
1-(3-chloro-4-methoxyphenyl)-2-(1,3-thiazol-2-ylsulfanyl)ethanone (PubChem CID 61218742) has the molecular formula C12H10ClNO2S2 and a molecular weight of 299.80 g/mol. Its IUPAC name is 1-(3-chloro-4-methoxyphenyl)-2-(1,3-thiazol-2-ylsulfanyl)ethanone.
| Compound Name | 1-(3-chloro-4-methoxyphenyl)-2-(1,3-thiazol-2-ylsulfanyl)ethanone |
|---|---|
| PubChem CID | 61218742 |
| Molecular Formula | C12H10ClNO2S2 |
| Molecular Weight | 299.80 g/mol |
| Exact Mass | 298.98 |
| IUPAC Name | 1-(3-chloro-4-methoxyphenyl)-2-(1,3-thiazol-2-ylsulfanyl)ethanone |
| SMILES | COc1ccc(C(=O)CSc2nccs2)cc1Cl |
| InChI | InChI=1S/C12H10ClNO2S2/c1-16-11-3-2-8(6-9(11)13)10(15)7-18-12-14-4-5-17-12/h2-6H,7H2,1H3 |
| InChIKey | IBPUILKRZCLMEE-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.80 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'} |
|---|