C20H13ClN2OS3 — CID 18207019
2-[[4-(4-chlorophenyl)-5-sulfanylidene-1,3,4-thiadiazol-2-yl]sulfanyl]-1-naphthalen-2-ylethanone (PubChem CID 18207019) has the molecular formula C20H13ClN2OS3 and a molecular weight of 428.99 g/mol. Its IUPAC name is 2-[[4-(4-chlorophenyl)-5-sulfanylidene-1,3,4-thiadiazol-2-yl]sulfanyl]-1-naphthalen-2-ylethanone.
| Compound Name | 2-[[4-(4-chlorophenyl)-5-sulfanylidene-1,3,4-thiadiazol-2-yl]sulfanyl]-1-naphthalen-2-ylethanone |
|---|---|
| PubChem CID | 18207019 |
| Molecular Formula | C20H13ClN2OS3 |
| Molecular Weight | 428.99 g/mol |
| Exact Mass | 427.99 |
| IUPAC Name | 2-[[4-(4-chlorophenyl)-5-sulfanylidene-1,3,4-thiadiazol-2-yl]sulfanyl]-1-naphthalen-2-ylethanone |
| SMILES | O=C(CSc1nn(-c2ccc(Cl)cc2)c(=S)s1)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C20H13ClN2OS3/c21-16-7-9-17(10-8-16)23-20(25)27-19(22-23)26-12-18(24)15-6-5-13-3-1-2-4-14(13)11-15/h1-11H,12H2 |
| InChIKey | FHWGOOJDXOFDKB-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.99 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|