C14H16ClN3OS3 — CID 2525801
N-tert-butyl-2-[[4-(4-chlorophenyl)-5-sulfanylidene-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide (PubChem CID 2525801) has the molecular formula C14H16ClN3OS3 and a molecular weight of 373.96 g/mol. Its IUPAC name is N-tert-butyl-2-[[4-(4-chlorophenyl)-5-sulfanylidene-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide.
| Compound Name | N-tert-butyl-2-[[4-(4-chlorophenyl)-5-sulfanylidene-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 2525801 |
| Molecular Formula | C14H16ClN3OS3 |
| Molecular Weight | 373.96 g/mol |
| Exact Mass | 373.01 |
| IUPAC Name | N-tert-butyl-2-[[4-(4-chlorophenyl)-5-sulfanylidene-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide |
| SMILES | CC(C)(C)NC(=O)CSc1nn(-c2ccc(Cl)cc2)c(=S)s1 |
| InChI | InChI=1S/C14H16ClN3OS3/c1-14(2,3)16-11(19)8-21-12-17-18(13(20)22-12)10-6-4-9(15)5-7-10/h4-7H,8H2,1-3H3,(H,16,19) |
| InChIKey | UAFCCXVZPSBFQR-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.96 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|