C17H14N2O2S3 — CID 84603930
benzyl 2-[(4-phenyl-5-sulfanylidene-1,3,4-thiadiazol-2-yl)sulfanyl]acetate (PubChem CID 84603930) has the molecular formula C17H14N2O2S3 and a molecular weight of 374.51 g/mol. Its IUPAC name is benzyl 2-[(4-phenyl-5-sulfanylidene-1,3,4-thiadiazol-2-yl)sulfanyl]acetate.
| Compound Name | benzyl 2-[(4-phenyl-5-sulfanylidene-1,3,4-thiadiazol-2-yl)sulfanyl]acetate |
|---|---|
| PubChem CID | 84603930 |
| Molecular Formula | C17H14N2O2S3 |
| Molecular Weight | 374.51 g/mol |
| Exact Mass | 374.02 |
| IUPAC Name | benzyl 2-[(4-phenyl-5-sulfanylidene-1,3,4-thiadiazol-2-yl)sulfanyl]acetate |
| SMILES | O=C(CSc1nn(-c2ccccc2)c(=S)s1)OCc1ccccc1 |
| InChI | InChI=1S/C17H14N2O2S3/c20-15(21-11-13-7-3-1-4-8-13)12-23-16-18-19(17(22)24-16)14-9-5-2-6-10-14/h1-10H,11-12H2 |
| InChIKey | FVEBUKDUHDPWOV-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.51 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|