C18H13N5OS4 — CID 55477572
4-(5-benzylsulfanyl-2-sulfanylidene-1,3,4-thiadiazol-3-yl)-N-(1,3,4-thiadiazol-2-yl)benzamide (PubChem CID 55477572) has the molecular formula C18H13N5OS4 and a molecular weight of 443.60 g/mol. Its IUPAC name is 4-(5-benzylsulfanyl-2-sulfanylidene-1,3,4-thiadiazol-3-yl)-N-(1,3,4-thiadiazol-2-yl)benzamide.
| Compound Name | 4-(5-benzylsulfanyl-2-sulfanylidene-1,3,4-thiadiazol-3-yl)-N-(1,3,4-thiadiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 55477572 |
| Molecular Formula | C18H13N5OS4 |
| Molecular Weight | 443.60 g/mol |
| Exact Mass | 443.00 |
| IUPAC Name | 4-(5-benzylsulfanyl-2-sulfanylidene-1,3,4-thiadiazol-3-yl)-N-(1,3,4-thiadiazol-2-yl)benzamide |
| SMILES | O=C(Nc1nncs1)c1ccc(-n2nc(SCc3ccccc3)sc2=S)cc1 |
| InChI | InChI=1S/C18H13N5OS4/c24-15(20-16-21-19-11-27-16)13-6-8-14(9-7-13)23-18(25)28-17(22-23)26-10-12-4-2-1-3-5-12/h1-9,11H,10H2,(H,20,21,24) |
| InChIKey | OOCBARIBFGMUCS-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.60 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|