C20H19N3O2S3 — CID 112762924
[4-(5-benzylsulfanyl-2-sulfanylidene-1,3,4-thiadiazol-3-yl)phenyl]-morpholin-4-ylmethanone (PubChem CID 112762924) has the molecular formula C20H19N3O2S3 and a molecular weight of 429.59 g/mol. Its IUPAC name is [4-(5-benzylsulfanyl-2-sulfanylidene-1,3,4-thiadiazol-3-yl)phenyl]-morpholin-4-ylmethanone.
| Compound Name | [4-(5-benzylsulfanyl-2-sulfanylidene-1,3,4-thiadiazol-3-yl)phenyl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 112762924 |
| Molecular Formula | C20H19N3O2S3 |
| Molecular Weight | 429.59 g/mol |
| Exact Mass | 429.06 |
| IUPAC Name | [4-(5-benzylsulfanyl-2-sulfanylidene-1,3,4-thiadiazol-3-yl)phenyl]-morpholin-4-ylmethanone |
| SMILES | O=C(c1ccc(-n2nc(SCc3ccccc3)sc2=S)cc1)N1CCOCC1 |
| InChI | InChI=1S/C20H19N3O2S3/c24-18(22-10-12-25-13-11-22)16-6-8-17(9-7-16)23-20(26)28-19(21-23)27-14-15-4-2-1-3-5-15/h1-9H,10-14H2 |
| InChIKey | JGWMYJZTRVWETH-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.59 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|