C20H20N4O4S4 — CID 2448291
N-(4-morpholin-4-ylsulfonylphenyl)-2-[(4-phenyl-5-sulfanylidene-1,3,4-thiadiazol-2-yl)sulfanyl]acetamide (PubChem CID 2448291) has the molecular formula C20H20N4O4S4 and a molecular weight of 508.67 g/mol. Its IUPAC name is N-(4-morpholin-4-ylsulfonylphenyl)-2-[(4-phenyl-5-sulfanylidene-1,3,4-thiadiazol-2-yl)sulfanyl]acetamide.
| Compound Name | N-(4-morpholin-4-ylsulfonylphenyl)-2-[(4-phenyl-5-sulfanylidene-1,3,4-thiadiazol-2-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 2448291 |
| Molecular Formula | C20H20N4O4S4 |
| Molecular Weight | 508.67 g/mol |
| Exact Mass | 508.04 |
| IUPAC Name | N-(4-morpholin-4-ylsulfonylphenyl)-2-[(4-phenyl-5-sulfanylidene-1,3,4-thiadiazol-2-yl)sulfanyl]acetamide |
| SMILES | O=C(CSc1nn(-c2ccccc2)c(=S)s1)Nc1ccc(S(=O)(=O)N2CCOCC2)cc1 |
| InChI | InChI=1S/C20H20N4O4S4/c25-18(14-30-19-22-24(20(29)31-19)16-4-2-1-3-5-16)21-15-6-8-17(9-7-15)32(26,27)23-10-12-28-13-11-23/h1-9H,10-14H2,(H,21,25) |
| InChIKey | IVBCTIVNEBOZNE-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.67 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|