C21H28N4O2S3 — CID 16564964
N-[(1-morpholin-4-ylcyclohexyl)methyl]-2-[(4-phenyl-5-sulfanylidene-1,3,4-thiadiazol-2-yl)sulfanyl]acetamide (PubChem CID 16564964) has the molecular formula C21H28N4O2S3 and a molecular weight of 464.68 g/mol. Its IUPAC name is N-[(1-morpholin-4-ylcyclohexyl)methyl]-2-[(4-phenyl-5-sulfanylidene-1,3,4-thiadiazol-2-yl)sulfanyl]acetamide.
| Compound Name | N-[(1-morpholin-4-ylcyclohexyl)methyl]-2-[(4-phenyl-5-sulfanylidene-1,3,4-thiadiazol-2-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 16564964 |
| Molecular Formula | C21H28N4O2S3 |
| Molecular Weight | 464.68 g/mol |
| Exact Mass | 464.14 |
| IUPAC Name | N-[(1-morpholin-4-ylcyclohexyl)methyl]-2-[(4-phenyl-5-sulfanylidene-1,3,4-thiadiazol-2-yl)sulfanyl]acetamide |
| SMILES | O=C(CSc1nn(-c2ccccc2)c(=S)s1)NCC1(N2CCOCC2)CCCCC1 |
| InChI | InChI=1S/C21H28N4O2S3/c26-18(15-29-19-23-25(20(28)30-19)17-7-3-1-4-8-17)22-16-21(9-5-2-6-10-21)24-11-13-27-14-12-24/h1,3-4,7-8H,2,5-6,9-16H2,(H,22,26) |
| InChIKey | HWSGVIBHTDIHDD-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.68 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|