C23H34N2O4 — CID 55475345
[2-[(1-morpholin-4-ylcyclohexyl)methylamino]-2-oxoethyl] 2-phenylbutanoate (PubChem CID 55475345) has the molecular formula C23H34N2O4 and a molecular weight of 402.54 g/mol. Its IUPAC name is [2-[(1-morpholin-4-ylcyclohexyl)methylamino]-2-oxoethyl] 2-phenylbutanoate.
| Compound Name | [2-[(1-morpholin-4-ylcyclohexyl)methylamino]-2-oxoethyl] 2-phenylbutanoate |
|---|---|
| PubChem CID | 55475345 |
| Molecular Formula | C23H34N2O4 |
| Molecular Weight | 402.54 g/mol |
| Exact Mass | 402.25 |
| IUPAC Name | [2-[(1-morpholin-4-ylcyclohexyl)methylamino]-2-oxoethyl] 2-phenylbutanoate |
| SMILES | CCC(C(=O)OCC(=O)NCC1(N2CCOCC2)CCCCC1)c1ccccc1 |
| InChI | InChI=1S/C23H34N2O4/c1-2-20(19-9-5-3-6-10-19)22(27)29-17-21(26)24-18-23(11-7-4-8-12-23)25-13-15-28-16-14-25/h3,5-6,9-10,20H,2,4,7-8,11-18H2,1H3,(H,24,26) |
| InChIKey | AQISLRZCQXSKFM-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.54 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |