C27H32N2O5 — CID 16569475
[2-[(1-morpholin-4-ylcyclohexyl)methylamino]-2-oxoethyl] 9H-xanthene-9-carboxylate (PubChem CID 16569475) has the molecular formula C27H32N2O5 and a molecular weight of 464.56 g/mol. Its IUPAC name is [2-[(1-morpholin-4-ylcyclohexyl)methylamino]-2-oxoethyl] 9H-xanthene-9-carboxylate.
| Compound Name | [2-[(1-morpholin-4-ylcyclohexyl)methylamino]-2-oxoethyl] 9H-xanthene-9-carboxylate |
|---|---|
| PubChem CID | 16569475 |
| Molecular Formula | C27H32N2O5 |
| Molecular Weight | 464.56 g/mol |
| Exact Mass | 464.23 |
| IUPAC Name | [2-[(1-morpholin-4-ylcyclohexyl)methylamino]-2-oxoethyl] 9H-xanthene-9-carboxylate |
| SMILES | O=C(COC(=O)C1c2ccccc2Oc2ccccc21)NCC1(N2CCOCC2)CCCCC1 |
| InChI | InChI=1S/C27H32N2O5/c30-24(28-19-27(12-6-1-7-13-27)29-14-16-32-17-15-29)18-33-26(31)25-20-8-2-4-10-22(20)34-23-11-5-3-9-21(23)25/h2-5,8-11,25H,1,6-7,12-19H2,(H,28,30) |
| InChIKey | OBTYEVUJPRFROL-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.56 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |