C22H29N3O6 — CID 16596089
[2-[(1-morpholin-4-ylcyclohexyl)methylamino]-2-oxoethyl] (E)-3-(2-nitrophenyl)prop-2-enoate (PubChem CID 16596089) has the molecular formula C22H29N3O6 and a molecular weight of 431.49 g/mol. Its IUPAC name is [2-[(1-morpholin-4-ylcyclohexyl)methylamino]-2-oxoethyl] (E)-3-(2-nitrophenyl)prop-2-enoate.
| Compound Name | [2-[(1-morpholin-4-ylcyclohexyl)methylamino]-2-oxoethyl] (E)-3-(2-nitrophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 16596089 |
| Molecular Formula | C22H29N3O6 |
| Molecular Weight | 431.49 g/mol |
| Exact Mass | 431.21 |
| IUPAC Name | [2-[(1-morpholin-4-ylcyclohexyl)methylamino]-2-oxoethyl] (E)-3-(2-nitrophenyl)prop-2-enoate |
| SMILES | O=C(COC(=O)/C=C/c1ccccc1[N+](=O)[O-])NCC1(N2CCOCC2)CCCCC1 |
| InChI | InChI=1S/C22H29N3O6/c26-20(16-31-21(27)9-8-18-6-2-3-7-19(18)25(28)29)23-17-22(10-4-1-5-11-22)24-12-14-30-15-13-24/h2-3,6-9H,1,4-5,10-17H2,(H,23,26)/b9-8+ |
| InChIKey | MZSGDLJEZZZBSW-CMDGGOBGSA-N |
| XLogP | 2.30 |
| TPSA | 111.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.49 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|