C25H22N4O3S — CID 3479065
3-[4-(morpholine-4-carbonyl)phenyl]-2-(pyridin-3-ylmethylsulfanyl)quinazolin-4-one (PubChem CID 3479065) has the molecular formula C25H22N4O3S and a molecular weight of 458.54 g/mol. Its IUPAC name is 3-[4-(morpholine-4-carbonyl)phenyl]-2-(pyridin-3-ylmethylsulfanyl)quinazolin-4-one.
| Compound Name | 3-[4-(morpholine-4-carbonyl)phenyl]-2-(pyridin-3-ylmethylsulfanyl)quinazolin-4-one |
|---|---|
| PubChem CID | 3479065 |
| Molecular Formula | C25H22N4O3S |
| Molecular Weight | 458.54 g/mol |
| Exact Mass | 458.14 |
| IUPAC Name | 3-[4-(morpholine-4-carbonyl)phenyl]-2-(pyridin-3-ylmethylsulfanyl)quinazolin-4-one |
| SMILES | O=C(c1ccc(-n2c(SCc3cccnc3)nc3ccccc3c2=O)cc1)N1CCOCC1 |
| InChI | InChI=1S/C25H22N4O3S/c30-23(28-12-14-32-15-13-28)19-7-9-20(10-8-19)29-24(31)21-5-1-2-6-22(21)27-25(29)33-17-18-4-3-11-26-16-18/h1-11,16H,12-15,17H2 |
| InChIKey | IZDRWXNOKCQDEN-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 77.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.54 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |