C27H25N3O4S — CID 46362524
2-benzylsulfanyl-3-(3-methoxyphenyl)-7-(morpholine-4-carbonyl)quinazolin-4-one (PubChem CID 46362524) has the molecular formula C27H25N3O4S and a molecular weight of 487.58 g/mol. Its IUPAC name is 2-benzylsulfanyl-3-(3-methoxyphenyl)-7-(morpholine-4-carbonyl)quinazolin-4-one.
| Compound Name | 2-benzylsulfanyl-3-(3-methoxyphenyl)-7-(morpholine-4-carbonyl)quinazolin-4-one |
|---|---|
| PubChem CID | 46362524 |
| Molecular Formula | C27H25N3O4S |
| Molecular Weight | 487.58 g/mol |
| Exact Mass | 487.16 |
| IUPAC Name | 2-benzylsulfanyl-3-(3-methoxyphenyl)-7-(morpholine-4-carbonyl)quinazolin-4-one |
| SMILES | COc1cccc(-n2c(SCc3ccccc3)nc3cc(C(=O)N4CCOCC4)ccc3c2=O)c1 |
| InChI | InChI=1S/C27H25N3O4S/c1-33-22-9-5-8-21(17-22)30-26(32)23-11-10-20(25(31)29-12-14-34-15-13-29)16-24(23)28-27(30)35-18-19-6-3-2-4-7-19/h2-11,16-17H,12-15,18H2,1H3 |
| InChIKey | GLTRIKLOJBGQPJ-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 73.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.58 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |