C21H17N3O2S3 — CID 60529543
N-(furan-2-ylmethyl)-3-[(4-phenyl-5-sulfanylidene-1,3,4-thiadiazol-2-yl)sulfanylmethyl]benzamide (PubChem CID 60529543) has the molecular formula C21H17N3O2S3 and a molecular weight of 439.59 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-3-[(4-phenyl-5-sulfanylidene-1,3,4-thiadiazol-2-yl)sulfanylmethyl]benzamide.
| Compound Name | N-(furan-2-ylmethyl)-3-[(4-phenyl-5-sulfanylidene-1,3,4-thiadiazol-2-yl)sulfanylmethyl]benzamide |
|---|---|
| PubChem CID | 60529543 |
| Molecular Formula | C21H17N3O2S3 |
| Molecular Weight | 439.59 g/mol |
| Exact Mass | 439.05 |
| IUPAC Name | N-(furan-2-ylmethyl)-3-[(4-phenyl-5-sulfanylidene-1,3,4-thiadiazol-2-yl)sulfanylmethyl]benzamide |
| SMILES | O=C(NCc1ccco1)c1cccc(CSc2nn(-c3ccccc3)c(=S)s2)c1 |
| InChI | InChI=1S/C21H17N3O2S3/c25-19(22-13-18-10-5-11-26-18)16-7-4-6-15(12-16)14-28-20-23-24(21(27)29-20)17-8-2-1-3-9-17/h1-12H,13-14H2,(H,22,25) |
| InChIKey | AWVBFDXXWKPKIP-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 60.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.59 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|