C11H12BrN3OS — CID 104588095
5-[2-(3-bromophenoxy)ethylsulfanyl]-1-methyl-1,2,4-triazole (PubChem CID 104588095) has the molecular formula C11H12BrN3OS and a molecular weight of 314.21 g/mol. Its IUPAC name is 5-[2-(3-bromophenoxy)ethylsulfanyl]-1-methyl-1,2,4-triazole.
| Compound Name | 5-[2-(3-bromophenoxy)ethylsulfanyl]-1-methyl-1,2,4-triazole |
|---|---|
| PubChem CID | 104588095 |
| Molecular Formula | C11H12BrN3OS |
| Molecular Weight | 314.21 g/mol |
| Exact Mass | 312.99 |
| IUPAC Name | 5-[2-(3-bromophenoxy)ethylsulfanyl]-1-methyl-1,2,4-triazole |
| SMILES | Cn1ncnc1SCCOc1cccc(Br)c1 |
| InChI | InChI=1S/C11H12BrN3OS/c1-15-11(13-8-14-15)17-6-5-16-10-4-2-3-9(12)7-10/h2-4,7-8H,5-6H2,1H3 |
| InChIKey | ZTYYXEALWFBIJH-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.21 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|