C18H19BrN4O3S — CID 24670947
3-[2-(3-bromophenoxy)ethylsulfanyl]-5-[(3-methoxyphenoxy)methyl]-1,2,4-triazol-4-amine (PubChem CID 24670947) has the molecular formula C18H19BrN4O3S and a molecular weight of 451.35 g/mol. Its IUPAC name is 3-[2-(3-bromophenoxy)ethylsulfanyl]-5-[(3-methoxyphenoxy)methyl]-1,2,4-triazol-4-amine.
| Compound Name | 3-[2-(3-bromophenoxy)ethylsulfanyl]-5-[(3-methoxyphenoxy)methyl]-1,2,4-triazol-4-amine |
|---|---|
| PubChem CID | 24670947 |
| Molecular Formula | C18H19BrN4O3S |
| Molecular Weight | 451.35 g/mol |
| Exact Mass | 450.04 |
| IUPAC Name | 3-[2-(3-bromophenoxy)ethylsulfanyl]-5-[(3-methoxyphenoxy)methyl]-1,2,4-triazol-4-amine |
| SMILES | COc1cccc(OCc2nnc(SCCOc3cccc(Br)c3)n2N)c1 |
| InChI | InChI=1S/C18H19BrN4O3S/c1-24-14-5-3-7-16(11-14)26-12-17-21-22-18(23(17)20)27-9-8-25-15-6-2-4-13(19)10-15/h2-7,10-11H,8-9,12,20H2,1H3 |
| InChIKey | OLFIGSBXKYAOJD-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.35 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|