C14H12BrN3OS — CID 60626196
3-[2-(3-bromophenoxy)ethylsulfanyl]-[1,2,4]triazolo[4,3-a]pyridine (PubChem CID 60626196) has the molecular formula C14H12BrN3OS and a molecular weight of 350.24 g/mol. Its IUPAC name is 3-[2-(3-bromophenoxy)ethylsulfanyl]-[1,2,4]triazolo[4,3-a]pyridine.
| Compound Name | 3-[2-(3-bromophenoxy)ethylsulfanyl]-[1,2,4]triazolo[4,3-a]pyridine |
|---|---|
| PubChem CID | 60626196 |
| Molecular Formula | C14H12BrN3OS |
| Molecular Weight | 350.24 g/mol |
| Exact Mass | 348.99 |
| IUPAC Name | 3-[2-(3-bromophenoxy)ethylsulfanyl]-[1,2,4]triazolo[4,3-a]pyridine |
| SMILES | Brc1cccc(OCCSc2nnc3ccccn23)c1 |
| InChI | InChI=1S/C14H12BrN3OS/c15-11-4-3-5-12(10-11)19-8-9-20-14-17-16-13-6-1-2-7-18(13)14/h1-7,10H,8-9H2 |
| InChIKey | WKPXDBVPYIBEMT-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 39.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.24 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|