C22H16BrF2N3OS — CID 2469543
3-[2-(3-bromophenoxy)ethylsulfanyl]-4-(2,4-difluorophenyl)-5-phenyl-1,2,4-triazole (PubChem CID 2469543) has the molecular formula C22H16BrF2N3OS and a molecular weight of 488.36 g/mol. Its IUPAC name is 3-[2-(3-bromophenoxy)ethylsulfanyl]-4-(2,4-difluorophenyl)-5-phenyl-1,2,4-triazole.
| Compound Name | 3-[2-(3-bromophenoxy)ethylsulfanyl]-4-(2,4-difluorophenyl)-5-phenyl-1,2,4-triazole |
|---|---|
| PubChem CID | 2469543 |
| Molecular Formula | C22H16BrF2N3OS |
| Molecular Weight | 488.36 g/mol |
| Exact Mass | 487.02 |
| IUPAC Name | 3-[2-(3-bromophenoxy)ethylsulfanyl]-4-(2,4-difluorophenyl)-5-phenyl-1,2,4-triazole |
| SMILES | Fc1ccc(-n2c(SCCOc3cccc(Br)c3)nnc2-c2ccccc2)c(F)c1 |
| InChI | InChI=1S/C22H16BrF2N3OS/c23-16-7-4-8-18(13-16)29-11-12-30-22-27-26-21(15-5-2-1-3-6-15)28(22)20-10-9-17(24)14-19(20)25/h1-10,13-14H,11-12H2 |
| InChIKey | PEHSJEKIPLOKOK-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.36 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|