C24H16F2N4O2S — CID 4636889
2-[2-[[4-(2,4-difluorophenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]ethyl]isoindole-1,3-dione (PubChem CID 4636889) has the molecular formula C24H16F2N4O2S and a molecular weight of 462.48 g/mol. Its IUPAC name is 2-[2-[[4-(2,4-difluorophenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]ethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-[[4-(2,4-difluorophenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 4636889 |
| Molecular Formula | C24H16F2N4O2S |
| Molecular Weight | 462.48 g/mol |
| Exact Mass | 462.10 |
| IUPAC Name | 2-[2-[[4-(2,4-difluorophenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]ethyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1CCSc1nnc(-c2ccccc2)n1-c1ccc(F)cc1F |
| InChI | InChI=1S/C24H16F2N4O2S/c25-16-10-11-20(19(26)14-16)30-21(15-6-2-1-3-7-15)27-28-24(30)33-13-12-29-22(31)17-8-4-5-9-18(17)23(29)32/h1-11,14H,12-13H2 |
| InChIKey | KAZVDRYKFNBKKF-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 68.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.48 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|