C22H16F3N3OS — CID 4579546
4-(2,4-difluorophenyl)-3-[2-(2-fluorophenoxy)ethylsulfanyl]-5-phenyl-1,2,4-triazole (PubChem CID 4579546) has the molecular formula C22H16F3N3OS and a molecular weight of 427.45 g/mol. Its IUPAC name is 4-(2,4-difluorophenyl)-3-[2-(2-fluorophenoxy)ethylsulfanyl]-5-phenyl-1,2,4-triazole.
| Compound Name | 4-(2,4-difluorophenyl)-3-[2-(2-fluorophenoxy)ethylsulfanyl]-5-phenyl-1,2,4-triazole |
|---|---|
| PubChem CID | 4579546 |
| Molecular Formula | C22H16F3N3OS |
| Molecular Weight | 427.45 g/mol |
| Exact Mass | 427.10 |
| IUPAC Name | 4-(2,4-difluorophenyl)-3-[2-(2-fluorophenoxy)ethylsulfanyl]-5-phenyl-1,2,4-triazole |
| SMILES | Fc1ccc(-n2c(SCCOc3ccccc3F)nnc2-c2ccccc2)c(F)c1 |
| InChI | InChI=1S/C22H16F3N3OS/c23-16-10-11-19(18(25)14-16)28-21(15-6-2-1-3-7-15)26-27-22(28)30-13-12-29-20-9-5-4-8-17(20)24/h1-11,14H,12-13H2 |
| InChIKey | SFYGIJNOHPGBDS-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.45 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|