C16H11F2NO2S — CID 8869917
2-[2-(2,5-difluorophenyl)sulfanylethyl]isoindole-1,3-dione (PubChem CID 8869917) has the molecular formula C16H11F2NO2S and a molecular weight of 319.33 g/mol. Its IUPAC name is 2-[2-(2,5-difluorophenyl)sulfanylethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-(2,5-difluorophenyl)sulfanylethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 8869917 |
| Molecular Formula | C16H11F2NO2S |
| Molecular Weight | 319.33 g/mol |
| Exact Mass | 319.05 |
| IUPAC Name | 2-[2-(2,5-difluorophenyl)sulfanylethyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1CCSc1cc(F)ccc1F |
| InChI | InChI=1S/C16H11F2NO2S/c17-10-5-6-13(18)14(9-10)22-8-7-19-15(20)11-3-1-2-4-12(11)16(19)21/h1-6,9H,7-8H2 |
| InChIKey | WHFQIDXWZXNKFZ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.33 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|