C18H17F2N2O2+ — CID 8687913
[(1R)-1-(2,4-difluorophenyl)ethyl]-[2-(1,3-dioxoisoindol-2-yl)ethyl]azanium (PubChem CID 8687913) has the molecular formula C18H17F2N2O2+ and a molecular weight of 331.34 g/mol. Its IUPAC name is [(1R)-1-(2,4-difluorophenyl)ethyl]-[2-(1,3-dioxoisoindol-2-yl)ethyl]azanium.
| Compound Name | [(1R)-1-(2,4-difluorophenyl)ethyl]-[2-(1,3-dioxoisoindol-2-yl)ethyl]azanium |
|---|---|
| PubChem CID | 8687913 |
| Molecular Formula | C18H17F2N2O2+ |
| Molecular Weight | 331.34 g/mol |
| Exact Mass | 331.13 |
| IUPAC Name | [(1R)-1-(2,4-difluorophenyl)ethyl]-[2-(1,3-dioxoisoindol-2-yl)ethyl]azanium |
| SMILES | C[C@@H]([NH2+]CCN1C(=O)c2ccccc2C1=O)c1ccc(F)cc1F |
| InChI | InChI=1S/C18H16F2N2O2/c1-11(13-7-6-12(19)10-16(13)20)21-8-9-22-17(23)14-4-2-3-5-15(14)18(22)24/h2-7,10-11,21H,8-9H2,1H3/p+1/t11-/m1/s1 |
| InChIKey | OUIOKFTXCSUTLB-LLVKDONJSA-O |
| XLogP | 1.89 |
| TPSA | 53.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.34 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|