C19H16FN3O2 — CID 86814917
4-[1-[2-(1,3-dioxoisoindol-2-yl)ethylamino]ethyl]-3-fluorobenzonitrile (PubChem CID 86814917) has the molecular formula C19H16FN3O2 and a molecular weight of 337.35 g/mol. Its IUPAC name is 4-[1-[2-(1,3-dioxoisoindol-2-yl)ethylamino]ethyl]-3-fluorobenzonitrile.
| Compound Name | 4-[1-[2-(1,3-dioxoisoindol-2-yl)ethylamino]ethyl]-3-fluorobenzonitrile |
|---|---|
| PubChem CID | 86814917 |
| Molecular Formula | C19H16FN3O2 |
| Molecular Weight | 337.35 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | 4-[1-[2-(1,3-dioxoisoindol-2-yl)ethylamino]ethyl]-3-fluorobenzonitrile |
| SMILES | CC(NCCN1C(=O)c2ccccc2C1=O)c1ccc(C#N)cc1F |
| InChI | InChI=1S/C19H16FN3O2/c1-12(14-7-6-13(11-21)10-17(14)20)22-8-9-23-18(24)15-4-2-3-5-16(15)19(23)25/h2-7,10,12,22H,8-9H2,1H3 |
| InChIKey | ISKCBDHAPUXBTO-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.35 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|