C16H17FN4O2S — CID 86814918
N-[2-[1-(4-cyano-2-fluorophenyl)ethylamino]ethyl]pyridine-3-sulfonamide (PubChem CID 86814918) has the molecular formula C16H17FN4O2S and a molecular weight of 348.40 g/mol. Its IUPAC name is N-[2-[1-(4-cyano-2-fluorophenyl)ethylamino]ethyl]pyridine-3-sulfonamide.
| Compound Name | N-[2-[1-(4-cyano-2-fluorophenyl)ethylamino]ethyl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 86814918 |
| Molecular Formula | C16H17FN4O2S |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | N-[2-[1-(4-cyano-2-fluorophenyl)ethylamino]ethyl]pyridine-3-sulfonamide |
| SMILES | CC(NCCNS(=O)(=O)c1cccnc1)c1ccc(C#N)cc1F |
| InChI | InChI=1S/C16H17FN4O2S/c1-12(15-5-4-13(10-18)9-16(15)17)20-7-8-21-24(22,23)14-3-2-6-19-11-14/h2-6,9,11-12,20-21H,7-8H2,1H3 |
| InChIKey | XVFXQROMYBZELN-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 94.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|